2-Amino-8-bromo-9-(b-D-ribofuranosyl)purine
2-Amino-8-bromo-9-(b-D-ribofuranosyl)purine, a synthesized compound with potential therapeutic ability for cancer and viral infections, serves as a nucleoside analogue by hindering DNA synthesis while inducing apoptosis in cancerous cells. Its antiviral properties have also been highlighted in its efficacy against a host of viral strains such as Hepatitis B and C.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3001-47-6 |
| Pricing | Inquire |
| Cas | 3001-47-6 |
| Molecular Weight | 346.14 |
| Molecular Formula | C10H12BrN5O4 |
| Canonical SMILES | C1=C2C(=NC(=N1)N)N(C(=N2)Br)C3C(C(C(O3)CO)O)O |