3-(3'-(TRIFLUOROMETHYL)PHENOXYMETHYL)PH&
3-(3'-(Trifluoromethyl)phenoxy)methyl)phenol is an indispensable compound for the biomedical sector. It is a bioactive compound that exhibits formidable potential as an active agent in the creation of pharmaceuticals addressing an array of ailments, such as cancer, inflammation, and cardiovascular disorders. Its remarkable affinity towards specific receptors highlights its significance in therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 870778-98-6 |
| Pricing | Inquire |
| Cas | 870778-98-6 |
| Molecular Weight | 296.051 |
| Molecular Formula | C14H12BF3O3 |
| Canonical SMILES | B(C1=CC(=CC=C1)COC2=CC=CC(=C2)C(F)(F)F)(O)O |