2-Amino-6-chloro-9-(3,5-di-O-acetyl-2-O-methyl-β-D-ribofuranosyl)-9H-purine
2-Amino-6-chloro-9-(3,5-di-O-acetyl-2-O-methyl-β-D-ribofuranosyl)-9H-purine has emerged as an exceptionally potent antiviral compound within the biomedical field. Scientific communities are increasingly relying on this compound to combat a plethora of viral infections, including herpes, hepatitis, and HIV. By intricately targeting crucial enzymes and impeding viral DNA/RNA synthesis, this product showcases remarkable inhibitory properties that effectively curtail viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 244184-56-3 |
| Pricing | Inquire |
| Cas | 244184-56-3 |
| Molecular Weight | 399.79 |
| Molecular Formula | C15H18ClN5O6 |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)N2C=NC3=C2N=C(N=C3Cl)N)OC)OC(=O)C |