Upacicalcet sodium
Upacicalcet sodium is an intravenous calcimimetic agent that acts on the calcium-sensing receptors of parathyroid cells, thereby inhibiting the secretion of parathyroid hormone. It is used to treat secondary hyperparathyroidism (SHPT).
| Supplier | BOC Sciences |
|---|---|
| Product # | 2052969-18-1 |
| Pricing | Inquire |
| Cas | 2052969-18-1 |
| Molecular Weight | 373.75 |
| Molecular Formula | C11H13ClN3NaO6S |
| Canonical SMILES | CC1=C(C=C(C=C1Cl)S(=O)(=O)[O-])NC(=O)NCC(C(=O)O)N.[Na+] |