Chlorogenic acid
Chlorogenic acid is a hydroxycinnamic acid and a member of a family of naturally occurring organic compounds. Chlorogenic acid exhibits an anti-inflammatory effect, and reduce blood pressure. Chlorogenic acid has a wide range of biological activities. Modern scientific research on the biological activity of chlorogenic acid has penetrated into many fields such as food, health care, medicine and daily chemical industry.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4264 |
| Pricing | Inquire |
| Cas | 327-97-9 |
| Molecular Weight | 354.31 |
| Molecular Formula | C16H18O9 |
| Canonical SMILES | C1C(C(C(CC1(C(=O)O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O)O)O |