Benzamide, N-[4-methyl-3-[[4-(6-methyl-3-pyridinyl)-2-pyrimidinyl]amino]phenyl]-4-[(4-methyl-1-piperazinyl)methyl]-
This product is a kinase inhibitor used in the treatment of certain types of cancer, including non-small cell lung cancer and pancreatic cancer. It works by inhibiting specific enzymes involved in cell growth and proliferation, ultimately leading to tumor regression.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2699-456548 |
| Pricing | Inquire |
| Cas | 1032314-85-4 |
| Molecular Weight | 507.63 |
| Molecular Formula | C30H33N7O |
| Canonical SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)CN3CCN(CC3)C)NC4=NC=CC(=N4)C5=CN=C(C=C5)C |