4-Methylphenyl b-D-galactopyranoside
4-Methylphenyl b-D-galactopyranoside is a valuable compound exhibiting potential as a substrate for various enzymatic assays and commonly employed in the biochemical analysis of glycoside hydrolases. This compound plays a crucial role in understanding and discovering novel therapeutic drugs, particularly in research related to carbohydrate metabolism and galactoside-specific enzymes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3150-22-9 |
| Pricing | Inquire |
| Cas | 3150-22-9 |
| Molecular Weight | 270.28 |
| Molecular Formula | C13H18O6 |
| Canonical SMILES | CC1=CC=C(C=C1)OC2C(C(C(C(O2)CO)O)O)O |