3-Demethyl colchicine 3-O-b-D-glucuronide
3-Demethyl colchicine 3-O-b-D-glucuronide is a potent medicinal compound used in the biomedical industry for its anti-inflammatory and antimitotic properties. It plays a crucial role in studying gout and acute flares by inhibiting microtubule polymerization and reducing neutrophil infiltration.
| Supplier | BOC Sciences |
|---|---|
| Product # | 913079-71-7 |
| Pricing | Inquire |
| Cas | 913079-71-7 |
| Molecular Weight | 561.53 |
| Molecular Formula | C27H31NO12 |
| Canonical SMILES | CC(=O)NC1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC4C(C(C(C(O4)C(=O)O)O)O)O |