HBV-IN-14
HBV-IN-14 is a potent inhibitor of covalently closed circular DNA (cccDNA). cccDNA serves as the template for viral RNA transcription and subsequent viral DNA generation. HBV-IN-14 is a pyridinopyrimidinones compound. HBV-IN-14 has the potential for the research of HBV infection.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2712529-19-4 |
| Pricing | Inquire |
| Cas | 2712529-19-4 |
| Molecular Weight | 428.87 |
| Molecular Formula | C22H21ClN2O5 |
| Canonical SMILES | CC1(CC(C1)OCCOC2=CC=C(C=C2)C3=CC(=O)N4C=CC=C(C4=N3)Cl)C(=O)O |