9-Nitroanthracene
9-Nitroanthracene (CAS# 602-60-8) is a precursor of anthraquinones, which are often used as photosensitizers used in photodynamic therapy (PDT). Anthraquinone is also an important precursor for drugs such as Emodin (E523000), Aloe-emodin (A575400), and Rufgallol. 9-nitroanthracene has potential application in cancer therapy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 602-60-8 |
| Pricing | Inquire |
| Cas | 602-60-8 |
| Molecular Weight | 223.23 |
| Molecular Formula | C14H9NO2 |
| Canonical SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2[N+](=O)[O-] |