Methyl 2,3,4-tri-O-benzyl-6-O-triisopropylsilyl-a-D-galactopyranoside
Methyl 2,3,4-tri-O-benzyl-6-O-triisopropylsilyl-a-D-galactopyranoside, a prominent compound in the field of biomedicine, serves as an indispensable asset. With its profound implications, this compound assumes a pivotal role in the synthesis of pharmaceuticals tailored to combat specific ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 162147-37-7 |
| Pricing | Inquire |
| Cas | 162147-37-7 |
| Molecular Weight | 620.89 |
| Molecular Formula | C37H52O6Si |
| Canonical SMILES | CC(C)[Si](C(C)C)(C(C)C)OCC1C(C(C(C(O1)OC)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |