Dabigatran Impurity 20
An impurity of Dabigatran. Dabigatran is a very potent anticoagulant, shows that the terminal phenyl can be substituted by the more hydrophilic 2-pyridyl group without substantial loss of activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2694-338808 |
| Pricing | Inquire |
| Cas | 1408238-39-0 |
| Molecular Weight | 613.71 |
| Molecular Formula | C33H39N7O5 |
| Canonical SMILES | CCCCCCOC(=O)NC(=N)C1=CC=C(C=C1)NCC2=NC3=C(N2C)C=CC(=C3)C(=O)N(CCC(=O)OC)C4=CC=CC=N4 |