PD-119819
PD-119819, a heterocyclic piperazine, is an extremely selective DA autoreceptor agonist. It binds [3H]haloperidol in tests in rats. It inhibits of spontaneous locomotor activity and inhibits of brain DA synthesis or neuronal firing in tests in rats.
| Supplier | BOC Sciences |
|---|---|
| Product # | 105277-43-8 |
| Pricing | Inquire |
| Cas | 105277-43-8 |
| Molecular Weight | 365.43 |
| Molecular Formula | C21H23N3O3 |
| Canonical SMILES | C1CN(CCN1CCCOC2=CC3=C(C=C2)C(=O)C=CO3)C4=CC=CC=N4 |