Etaqualone-[d5]
Etaqualone-[d5] is the labelled analogue of Etaqualone. Etaqualone is an analogue of methaqualone, a non-barbiturate sedative also known as Quaalude. It exhibits agonist activity for GABAA receptor, resulting in sedative, hypnotic, muscle relaxant and central nervous system depressant properties. It is marketed in some European countries as insomnia therapy.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005359 |
| Pricing | Inquire |
| Cas | 1794789-34-6 |
| Molecular Weight | 269.35 |
| Molecular Formula | C17H11D5N2O |
| Canonical SMILES | CCC1=CC=CC=C1N2C(=NC3=CC=CC=C3C2=O)C |