8-Benzyloxy-3'-deoxy-3'-fluoroguanosine
8-Benzyloxy-3'-deoxy-3'-fluoroguanosine, a highly significant compound utilized in the field of biomedicine, assumes a pivotal function in combating diverse viral infections and cancers. Its unique mechanism involves the inhibition of specific viruses, thereby showcasing potent antiviral characteristics. Moreover, its exceptional potential as an agent against cancer lies in its capacity to impede the growth and proliferation of malignant cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2389988-61-6 |
| Pricing | Inquire |
| Cas | 2389988-61-6 |
| Molecular Weight | 391.35 |
| Molecular Formula | C17H18FN5O5 |
| Canonical SMILES | C1=CC=C(C=C1)COC2=NC3=C(N2C4C(C(C(O4)CO)F)O)N=C(NC3=O)N |