2-Methoxy-1-naphthaleneboronic acid
Reactant for:• Design of phosphorus C,P-ligands for environmentally benign cross-coupling reactions• Sterically hindered Suzuki-Miyaura coupling• Palladium-catalyzed cross-coupling reactions• Deboronation homocoupling reactions• Copper-catalyzed N-arylation of imidazoles• Stereoselective preparation of biaryl compounds via palladium-catalyzed asymmetric Suzuki-Miyaura coupling
| Supplier | BOC Sciences |
|---|---|
| Product # | 104116-17-8 |
| Pricing | Inquire |
| Cas | 104116-17-8 |
| Molecular Weight | 202.01 |
| Molecular Formula | C11H11BO3 |
| Canonical SMILES | B(C1=C(C=CC2=CC=CC=C12)OC)(O)O |