3',5'-Di-O-benzoylthymidine
3',5'-Di-O-benzoylthymidine. A tremendously powerful antiviral agent, equipped with an exceptional capability to thwart viral replication and obstruct DNA synthesis. Its vast therapeutic potential renders it a distinguished candidate for treating various viral infections, which include the notorious herpes simplex virus and the malevolent cytomegalovirus.
| Supplier | BOC Sciences |
|---|---|
| Product # | 35898-30-7 |
| Pricing | Inquire |
| Cas | 35898-30-7 |
| Molecular Weight | 450.44 |
| Molecular Formula | C24H22N2O7 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |