2-(L-Fuco-tetrahydroxypentyl)-4(R)-1,3-thiazolidine-4-carboxylic acid
2-(L-Fuco-tetrahydroxypentyl)-4(R)-1,3-thiazolidine-4-carboxylic acid is a valuable compound in the biomedical industry. It is used in the development of therapeutics targeting specific diseases such as diabetes, as it exhibits potential hypoglycemic and anti-diabetic activities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 152983-87-4 |
| Pricing | Inquire |
| Cas | 152983-87-4 |
| Molecular Weight | 281.33 |
| Molecular Formula | C10H19NO6S |
| Canonical SMILES | CC(C(C(C(C1NC(CS1)C(=O)O)O)O)O)O |