Alternariol 9-methyl ether
Alternariol monomethyl ether is produced from the media of Alternaria alternata strain 261. Alternariol monomethyl ether, an Alternaria toxin, is a strong mutagen in Escherichia coli strain ND-160. Alternariol monomethyl ether possesses cytotoxic and immunosuppressive properties. It has genotoxic properties and can cause oxidative DNA damage.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-04145 |
| Pricing | Inquire |
| Cas | 23452-05-3 |
| Molecular Weight | 272.25 |
| Molecular Formula | C15H12O5 |
| Canonical SMILES | CC1=CC(=CC2=C1C3=CC(=CC(=C3C(=O)O2)O)OC)O |