4-bromoanilinium chloride
β-Ionone is essential oil extracted from the leaves and flowers of Succisa Pratensis that shows antioxidant and antimicrobial activities against bacteria. β-Ionone is effective in the induction of apoptosis in gastric adenocarcinoma SGC7901 cells. Anti-cancer activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 14901-07-6 |
| Pricing | Inquire |
| Cas | 14901-07-6 |
| Molecular Weight | 208.48348 |
| Molecular Formula | C6H7BrClN |
| Canonical SMILES | CC1=C(C(CCC1)(C)C)C=CC(=O)C |