4-Methylumbelliferone-[13C4]
4-Methylumbelliferone-[13C4] is the labelled analogue of 4-Methylumbelliferone. 4-Methylumbelliferone is a hyaluronic acid (HA) synthesis inhibitor with an IC50 of 0.4 mM, used as a choleretic and antispasmodic drug and as a standard for the fluorometric determination of enzyme activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002953 |
| Pricing | Inquire |
| Cas | 1569304-40-0 |
| Molecular Weight | 180.14 |
| Molecular Formula | C6[13C]4H8O3 |
| Canonical SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)O |