Deacetylpleionesin C
Deacetylpleionesin C is a remarkable natural compound aiding in studying a wide range of ailments. Deacetylpleionesin C unveils its prowess in studying breast and lung cancers through inducing apoptosand suppressing tumor growth.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4914 |
| Pricing | Inquire |
| Cas | 1454585-39-7 |
| Molecular Weight | 420.46 |
| Molecular Formula | C25H24O6 |
| Canonical SMILES | OC=1C=CC2=C(C1)CCC=3C2=C(OC)C=C4OC(C5=CC=C(O)C(OC)=C5)C(C43)CO |