8-Bromo-3-methylxanthine
8-Bromo-3-methylxanthine (CAS# 93703-24-3) is a substituted derivative of Xanthine (X499950), found in animal organs, yeast, potatoes, coffee beans, tea. It can also be used for the synthesis of Linagliptin (L465900), which is a novel potent and selective dipeptidyl peptidase-4 (DPP-4) inhibitor with potential use in the treatment of type 2 diabetes.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB041037 |
| Pricing | Inquire |
| Cas | 93703-24-3 |
| Molecular Weight | 245.03 |
| Molecular Formula | C6H5BrN4O2 |
| Canonical SMILES | CN1C2=C(C(=O)NC1=O)NC(=N2)Br |