2'-Deoxy-N4-DMF-5'-O-DMT-pseudoisocytidine 3'-CE phosphoramidite
2'-Deoxy-N4-DMF-5'-O-DMT-pseudoisocytidine 3'-CE phosphoramidite is an essential phosphoramidite derivative for oligonucleotide research and development, is extensively employed for advancing biomedical research and drug development. Its primary role lies in the modification of nucleic acids, empowering investigations on DNA and RNA structures, interactions, and functions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 307314-31-4 |
| Pricing | Inquire |
| Cas | 307314-31-4 |
| Molecular Weight | 784.88 |
| Molecular Formula | C42H53N6O7P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)C5=CN=C(NC5=O)N=CN(C)C |