Vinblastine-[13C,d3]
One of the isotopic labelled form of Vinblastine, which is an antitumor agent that is used for the treatment of kinds of cancers, including Hodgkin's lymphoma, non-small cell lung cancer, bladder cancer, brain cancer, melanoma, and testicular cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-007604 |
| Pricing | Inquire |
| Molecular Weight | 814.99 |
| Molecular Formula | C45[13C]H55D3N4O9 |
| Canonical SMILES | CCC1(CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O |