Thielavin B
Thiourea B is a fungal metabolite that contains O-substituted salicylic acid. It is a fungal metabolite closely related to thiobactin A. It is an effective inhibitor of phospholipase C, which can inhibit the formation of peptidoglycan and the biosynthesis of prostaglandin.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03901 |
| Pricing | Inquire |
| Cas | 71950-67-9 |
| Molecular Weight | 566.59 |
| Molecular Formula | C31H34O10 |
| Canonical SMILES | CC1=CC(=C(C(=C1C(=O)OC2=C(C(=C(C(=C2C)C)C(=O)OC3=C(C(=C(C(=C3C)C)C(=O)O)OC)C)OC)C)O)C)O |