1α,25-Dihydroxyvitamin D3 (6,19,19-[d3])
1α,25-Dihydroxyvitamin D3 (6,19,19-[d3]) is intended for use as an internal standard for calcitriol. Calcitriol is synthesized from 7-dehydro cholesterol in humans via a non-enzymatic photochemical reaction with 290-310 nm UV light in the skin. Calcitriol is also the biologically active form of Vitamin D3.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005624 |
| Pricing | Inquire |
| Cas | 128723-16-0 |
| Molecular Weight | 419.65 |
| Molecular Formula | C27D3H41O3 |
| Canonical SMILES | CC(CCCC(C)(C)O)C1CCC2C1(CCCC2=CC=C3CC(CC(C3=C)O)O)C |