Teglarinad chloride
Teglarinad chloride, also known as GMX1777, is a water-soluble prodrug of a cyanoguanidine compound with potential antineoplastic activity. In vivo, teglarinad chloride is rapidly converted into active drug through hydrolytic cleavage of a carbonate ester bond. Although the exact mechanism of action has yet to be fully elucidated, the active drug appears to antagonize nuclear factor-kappa B (NF-kB) transcription, resulting in the induction of tumor cell apoptosis.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-092359 |
| Pricing | Inquire |
| Cas | 432037-57-5 |
| Molecular Weight | 672.61 |
| Molecular Formula | C30H43Cl2N5O8 |
| Canonical SMILES | COCCOCCOCCOCCOC(=O)OC[N+]1=CC=C(C=C1)NC(=NCCCCCCOC2=CC=C(C=C2)Cl)NC#N.[Cl-] |