1,3,4,6-Tetra-O-acetyl-2-deoxy-2-trifluoracetamido-D-glucose (α/β mixture)
1,3,4,6-Tetra-O-acetyl-2-deoxy-2-trifluoracetamido-D-glucose (α/β mixture), an indispensable molecule in the realm of biomedical research, showcases its pivotality in the synthesis of avant-garde antiviral therapeutics catering to diverse ailments. By suppressing viral replication, this compound's unparalleled architecture empowers the combat against influenza, HIV, and other viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 137766-83-7 |
| Pricing | Inquire |
| Cas | 137766-83-7 |
| Molecular Weight | 443.33 |
| Molecular Formula | C16H20F3NO10 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)NC(=O)C(F)(F)F)OC(=O)C)OC(=O)C |