Fipronil carboxamide
Fipronil carboxamide is an impurity of Fipronil. Fipronil is a broad-spectrum insecticide that disrupts the insect central nervous system by blocking GABA-gated chloride channels and glutamate-gated chloride channels, resulting in central nervous system toxicity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 205650-69-7 |
| Pricing | Inquire |
| Cas | 205650-69-7 |
| Molecular Weight | 455.156 |
| Molecular Formula | C12H6Cl2F6N4O2S |
| Canonical SMILES | C1=C(C=C(C(=C1Cl)N2C(=C(C(=N2)C(=O)N)S(=O)C(F)(F)F)N)Cl)C(F)(F)F |