N4-Benzoyl-3'-O-tert-butyldimethylsilyl-5'-O-DMT-cytidine
N4-Benzoyl-3'-O-tert-butyldimethylsilyl-5'-O-DMT-cytidine, an influential therapeutic agent, stands as a formidable solution for combating viral infections such as hepatitis C and HIV. By harmoniously intertwining the antiviral attributes of cytidine with the defensive capabilities endowed by tert-butyldimethylsilyl and DMT groups, this compound markedly amplifies drug sturdiness and effectiveness.
| Supplier | BOC Sciences |
|---|---|
| Product # | 81246-78-8 |
| Pricing | Inquire |
| Cas | 81246-78-8 |
| Molecular Weight | 763.95 |
| Molecular Formula | C43H49N3O8Si |
| Canonical SMILES | CC(C)(C)[Si](C)(C)OC1C(OC(C1O)N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC |