Tigloylgomisin H
Tigloylgomisin H is isolated from the fruits of Schisandra chinensis. Tigloylgomisin H can significantly induce quinone reductase activity in Hepa1c1c7 mouse hepatocarcinoma cells, and it functions as a novel monofunctional inducer that specifically upregulates phase II enzymes through the Nrf2-ARE pathway, thus it represents a potential liver cancer prevention agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4099 |
| Pricing | Inquire |
| Cas | 66069-55-4 |
| Molecular Weight | 500.59 |
| Molecular Formula | C28H36O8 |
| Canonical SMILES | CC=C(C)C(=O)OC1=C2C(=CC(=C1OC)OC)CC(C(CC3=CC(=C(C(=C32)OC)OC)OC)(C)O)C |