Palbociclib Impurity 80
Palbociclib Impurity 80 is an impurity of Palbociclib, a medication for the treatment of HR-positive and HER2-negative breast cancer. It is a selective inhibitor of the cyclin-dependent kinases CDK4 and CDK6.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2624141-94-0 |
| Pricing | Inquire |
| Cas | 2624141-94-0 |
| Molecular Weight | 461.57 |
| Molecular Formula | C25H31N7O2 |
| Canonical SMILES | CC1=C(C(=O)N(C2=NC(=NC=C12)NC3=NC=C(C=C3)N4CCNCC4)C5CCCCC5)C(=O)C |