Eprosartan Ethyl Methyl Diester-[d5]
Eprosartan Ethyl Methyl Diester-[d5] is the labelled analogue of Eprosartan Ethyl Methyl Diester, which is an intermediate of Eprosartan. Eprosartan is an angiotensin II receptor antagonist used for the treatment of high blood pressure.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005327 |
| Pricing | Inquire |
| Cas | 1346606-20-9 |
| Molecular Weight | 471.62 |
| Molecular Formula | C26H25D5N2O4S |
| Canonical SMILES | CCCCC1=NC=C(N1CC2=CC=C(C=C2)C(=O)OC)C=C(CC3=CC=CS3)C(=O)OCC |