4-Chloro-2-cyclopentylphenyl b-D-galactopyranoside
4-Chloro-2-cyclopentylphenyl b-D-galactopyranoside is a valuable compound widely used in the biomedical industry playing a crucial role in the study of carbohydrate metabolism and glycosylation processes. It serves as a key tool for investigating diseases associated with abnormal galactoside metabolism and assessing potential drug interactions in studying these conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 24718-43-2 |
| Pricing | Inquire |
| Cas | 24718-43-2 |
| Molecular Weight | 358.81 |
| Molecular Formula | C17H23ClO6 |
| Canonical SMILES | C1CCC(C1)C2=C(C=CC(=C2)Cl)OC3C(C(C(C(O3)CO)O)O)O |