2,3-Di-O-benzyl-D-glucopyranose
2,3-Di-O-benzyl-D-glucopyranose, an indispensable element in biomedicine, finds its utilization in the synthesis of pharmaceuticals and the exploration of carbohydrates. Its presence significantly contributes to the advancement of drug development, targeting afflictions such as diabetes, obesity, and cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 18933-71-6 |
| Pricing | Inquire |
| Cas | 18933-71-6 |
| Molecular Weight | 360.40 |
| Molecular Formula | C20H24O6 |
| Canonical SMILES | C1=CC=C(C=C1)COC2C(C(OC(C2OCC3=CC=CC=C3)O)CO)O |