4-(2-Aminoethyl)benzenesulfonamide
4-(2-Aminoethyl)benzenesulfonamide (CAS# 35303-76-5) is used as the starting material in the synthesis of Des(5-methylpyrazinecarbonyl) trans-4-Methyl Glipizide (D292605); a degradation product of Glimepiride (G410150) which is a sulfonylurea hypoglycemic agent and an antidiabetic. 4-(2-Aminoethyl)benzenesulfonamide is also used as a reagent in the synthesis of deorphaning pyrrolopyrazines as potent multi-target antimalarial agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | 35303-76-5 |
| Pricing | Inquire |
| Cas | 35303-76-5 |
| Molecular Weight | 200.26 |
| Molecular Formula | C8H12N2O2S |
| Canonical SMILES | C1=CC(=CC=C1CCN)S(=O)(=O)N |