Desdiacetyl-8-oxo Famciclovir-[d4]
Desdiacetyl-8-oxo Famciclovir-[d4], is the labelled analogue of Desdiacetyl-8-oxo Famciclovir, which is a metabolite of Famciclovir. Famciclovir is a guanosine analogue antiviral drug used for the treatment of various herpesvirus infections, most commonly for herpes zoster.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002507 |
| Pricing | Inquire |
| Cas | 1346603-55-1 |
| Molecular Weight | 257.28 |
| Molecular Formula | C10H11D4N5O3 |
| Canonical SMILES | C1=C2C(=NC(=N1)N)N(C(=O)N2)CCC(CO)CO |