API-1
Akt/protein kinase B (PKB) inhibitor. Binds the pleckstrin homology domain of Akt and blocks Akt membrane translocation. Inhibits EGF-induced kinase activity of Akt1, Akt2 and Akt3. Induces cell growt h arrest and apoptosis in human cancer cells expressing constitutively active Akt.
| Supplier | BOC Sciences |
|---|---|
| Product # | 36707-00-3 |
| Pricing | Inquire |
| Cas | 36707-00-3 |
| Molecular Weight | 337.29 |
| Molecular Formula | C28H30FN5O2 |
| Canonical SMILES | C1=C(C(=O)C2=C(N1C3C(C(C(O3)CO)O)O)N=CN=C2N)C(=O)N |