cis- Ligupurpuroside B
cis-Ligupurpuroside B is an eminent naturally occurring compound, dominantly present in select botanical species. It holds immense promise for studying a gamut of ailments encompassing cancer, inflammation and oxidative stress-associated maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 350588-96-4 |
| Pricing | Inquire |
| Cas | 350588-96-4 |
| Molecular Weight | 738.74 |
| Molecular Formula | C35H46O17 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(C(OC(C3OC(=O)C=CC4=CC=C(C=C4)O)CO)OCCC5=CC=C(C=C5)O)O)C)O)O)O |