2,5-dioxopyrrolidin-1-yl 19-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-19-oxo-4,7,10,13,16-pentaoxanonadecan-1-oate
2,5-dioxopyrrolidin-1-yl 19-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-19-oxo-4,7,10,13,16-pentaoxanonadecan-1 -oate is an innovative biomedical chemical. Utilizing its unique chemical composition, it actively disrupts malignant molecular pathways to prevent tumor proliferation. Its superb targeted delivery capabilities act as a catalyst, amplifying the therapeutic effects and propelling it to the forefront of promising targeted cancer treatment candidates.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-00437 |
| Pricing | Inquire |
| Cas | 1232769-29-7 |
| Molecular Weight | 514.48 |
| Molecular Formula | C22H30N2O12 |
| Canonical SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCC(=O)N2C(=O)C=CC2=O |