PROTAC BRD4 Degrader-12
PROTAC BRD4 Degrader-12, a PROTAC connected by ligands for von Hippel-Lindau and BRD4, can be conjugated with STEAP1 and CLL1 antibodies to degrade the BRD4 protein in PC3 prostate cancer cells, with DC50s of 0.39 and 0.24 nM, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-01387 |
| Pricing | Inquire |
| Cas | 2417370-90-0 |
| Molecular Weight | 1306.58 |
| Molecular Formula | C62H77F2N9O12S4 |
| Canonical SMILES | CC1=C(SC=N1)C2=CC=C(C=C2)CNC(=O)C3CC(CN3C(=O)C(C(C)(C)C)NC(=O)CCCCCCCCCCNC(=O)C4=CC5=C(C=C4CS(=O)(=O)C)C6=CN(C(=O)C7=C6C(=CN7)CN5C8=C(C=C(C=N8)F)F)C)OC(=O)OC(C)C(C)SS(=O)(=O)C |