Fmoc-L-alanine
N-Fmoc-L-alanine is a Fmoc-protected form of L-Alanine. L-Alanine is used to make in-vivo measurement of glucose and alanine metabolism in studies of patients with diabetes. L-Alanine is a non-essential amino acid for human development and is one of the 20 amino acids encoded by the genetic code.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-003730 |
| Pricing | Inquire |
| Cas | 35661-39-3 |
| Molecular Weight | 311.30 |
| Molecular Formula | C18H17NO4 |
| Canonical SMILES | CC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |