Batatasin IV
Batatasin IV is a naturally occurring compound found in sweet potatoes. It exhibits potential anti-cancer properties by inhibiting tumor growth and inducing apoptosis in cancer cells. Batatasin IV can be used in the development of novel anticancer drugs for various types of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4930 |
| Pricing | Inquire |
| Cas | 60347-67-3 |
| Molecular Weight | 244.28 |
| Molecular Formula | C15H16O3 |
| Canonical SMILES | COC1=CC(=CC(=C1)O)CCC2=CC=CC=C2O |