3',5'-Di-O-Benzoyl-N4-benzoyl-2'-deoxy-2'-fluoroarabinocytidine
2'-Deoxy-3'-fluoroarabinocytidine with N4- and 3'-O-benzoyl substituents is a highly efficacious antiviral agent employed in the biomedical sector. This remarkable compound displays exceptional efficacy against an array of viral afflictions, encompassing both HIV and hepatitis C. Capitalizing on its distinctive molecular architecture, this offering hampers viral replication through targeted interruption of pivotal enzymes indispensable for viral proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 121353-90-0 |
| Pricing | Inquire |
| Cas | 121353-90-0 |
| Molecular Weight | 557.50 |
| Molecular Formula | C30H24FN3O7 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)NC2=NC(=O)N(C=C2)C3C(C(C(O3)COC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)F |