6-Chloro-9-(β-D-ribofuranosyl)purine
6-Chloro-9-(β-D-ribofuranosyl)purine, a potent pharmaceutical compound, finds its application in combating chemotherapy-induced emesis and radiation sickness. Its remarkable antiviral activity thwarts diverse viral infections by effectively impeding viral replication. Additionally, this product serves as an invaluable nucleoside analog for cutting-edge research pertaining to nucleic acids and nucleotide metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2004-06-0 |
| Pricing | Inquire |
| Cas | 2004-06-0 |
| Molecular Weight | 286.67 |
| Molecular Formula | C10H11ClN4O4 |
| Canonical SMILES | C1=NC2=C(C(=N1)Cl)N=CN2C3C(C(C(O3)CO)O)O |