H-D-3-Pal-OH 2HCl
H-D-3-Pal-OH 2HCl, a synthetic peptide of scientific interest, has the potential to be a promising avenue in the pursuit of new treatments for diseases of varying kinds. Research into the properties of this compound suggests its ability to inhibit cell proliferation and promote apoptosis in oncogenic cells. Interestingly, it may also function as an immunomodulator and possess therapeutic applications towards autoimmune disorders. These findings speak to the complex and multifaceted nature of H-D-3-Pal-OH 2HCl and the implications it could have in furthering scientific understanding of these conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-004823 |
| Pricing | Inquire |
| Cas | 93960-21-5 |
| Molecular Weight | 239.10 |
| Molecular Formula | C8H12Cl2N2O2 |
| Canonical SMILES | C1=CC(=CN=C1)CC(C(=O)O)N.Cl.Cl |