Juglomycin A
Juglomycin A is originally isolated from Str. distatochromogenes var. juglonensis 190-2. It has a broad spectrum of antibacterial and mycobacterial effects, and has the effect of inhibiting ehrlician ascites cancer in mice and prolongating life with 1 mg/kg.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01523 |
| Pricing | Inquire |
| Cas | 38637-88-6 |
| Molecular Weight | 274.22 |
| Molecular Formula | C14H10O6 |
| Canonical SMILES | C1C(C(OC1=O)C2=CC(=O)C3=C(C2=O)C=CC=C3O)O |