Azoxystrobin-[d4]
Azoxystrobin-[d4] is the labelled analogue of Azoxystrobin. Azoxystrobin is a systemic fungicide commonly used in agriculture. It is used as an active agent protecting plants and fruit/vegetables from fungal diseases. It inhibits mitochondrial respiration by blocking electron transfer between cytochromes b and c1.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-011802 |
| Pricing | Inquire |
| Cas | 1346606-39-0 |
| Molecular Weight | 407.42 |
| Molecular Formula | C22H13D4N3O5 |
| Canonical SMILES | COC=C(C1=CC=CC=C1OC2=NC=NC(=C2)OC3=CC=CC=C3C#N)C(=O)OC |