Methyl 2,4,6-tri-O-acetyl-b-D-glucopyranoside
Methyl 2,4,6-tri-O-acetyl-b-D-glucopyranoside is a multifaceted compound assuming a pivotal role as a fundamental constituent in the fabrication of pharmacologically active substances and intricate molecular constructs. It aids in studying afflictions such as diabetes mellitus and malignant neoplasms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 92008-11-2 |
| Pricing | Inquire |
| Cas | 92008-11-2 |
| Molecular Weight | 320.29 |
| Molecular Formula | C13H20O9 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC)OC(=O)C)O)OC(=O)C |